C24H24N8O4 — CID 70617138
N-[4-[2-[4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]phenyl]ethenyl]phenyl]-4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 70617138) has the molecular formula C24H24N8O4 and a molecular weight of 488.51 g/mol. Its IUPAC name is N-[4-[2-[4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]phenyl]ethenyl]phenyl]-4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-[4-[2-[4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]phenyl]ethenyl]phenyl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 70617138 |
| Molecular Formula | C24H24N8O4 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[4-[2-[4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]phenyl]ethenyl]phenyl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(Nc2ccc(C=Cc3ccc(Nc4nc(OC)nc(OC)n4)cc3)cc2)nc(OC)n1 |
| InChI | InChI=1S/C24H24N8O4/c1-33-21-27-19(28-22(31-21)34-2)25-17-11-7-15(8-12-17)5-6-16-9-13-18(14-10-16)26-20-29-23(35-3)32-24(30-20)36-4/h5-14H,1-4H3,(H,25,27,28,31)(H,26,29,30,32) |
| InChIKey | VWPJKALWZYZMHR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|