C34H29N10NaO5S — CID 59668393
sodium 2-N-[4-[2-[4-[(4-anilino-6-methoxy-1,3,5-triazin-2-yl)amino]-2-oxidoperoxysulfanylphenyl]ethenyl]phenyl]-6-methoxy-4-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 59668393) has the molecular formula C34H29N10NaO5S and a molecular weight of 712.73 g/mol. Its IUPAC name is sodium 2-N-[4-[2-[4-[(4-anilino-6-methoxy-1,3,5-triazin-2-yl)amino]-2-oxidoperoxysulfanylphenyl]ethenyl]phenyl]-6-methoxy-4-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | sodium 2-N-[4-[2-[4-[(4-anilino-6-methoxy-1,3,5-triazin-2-yl)amino]-2-oxidoperoxysulfanylphenyl]ethenyl]phenyl]-6-methoxy-4-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 59668393 |
| Molecular Formula | C34H29N10NaO5S |
| Molecular Weight | 712.73 g/mol |
| Exact Mass | 712.19 |
| IUPAC Name | sodium 2-N-[4-[2-[4-[(4-anilino-6-methoxy-1,3,5-triazin-2-yl)amino]-2-oxidoperoxysulfanylphenyl]ethenyl]phenyl]-6-methoxy-4-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1nc(Nc2ccccc2)nc(Nc2ccc(C=Cc3ccc(Nc4nc(Nc5ccccc5)nc(OC)n4)cc3SOO[O-])cc2)n1.[Na+] |
| InChI | InChI=1S/C34H30N10O5S.Na/c1-46-33-41-29(35-24-9-5-3-6-10-24)39-31(43-33)37-26-18-14-22(15-19-26)13-16-23-17-20-27(21-28(23)50-49-48-45)38-32-40-30(42-34(44-32)47-2)36-25-11-7-4-8-12-25;/h3-21,45H,1-2H3,(H2,35,37,39,41,43)(H2,36,38,40,42,44);/q;+1/p-1 |
| InChIKey | FOVDMVDMSQVHHX-UHFFFAOYSA-M |
| XLogP | 3.45 |
| TPSA | 185.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.73 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|