C26H28N8O3S — CID 59775478
N-[4-[(E)-2-[4-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]-2-methoxyperoxysulfanylphenyl]ethenyl]-3-methylphenyl]-4,6-dimethyl-1,3,5-triazin-2-amine (PubChem CID 59775478) has the molecular formula C26H28N8O3S and a molecular weight of 532.63 g/mol. Its IUPAC name is N-[4-[(E)-2-[4-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]-2-methoxyperoxysulfanylphenyl]ethenyl]-3-methylphenyl]-4,6-dimethyl-1,3,5-triazin-2-amine.
| Compound Name | N-[4-[(E)-2-[4-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]-2-methoxyperoxysulfanylphenyl]ethenyl]-3-methylphenyl]-4,6-dimethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 59775478 |
| Molecular Formula | C26H28N8O3S |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | N-[4-[(E)-2-[4-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]-2-methoxyperoxysulfanylphenyl]ethenyl]-3-methylphenyl]-4,6-dimethyl-1,3,5-triazin-2-amine |
| SMILES | COOOSc1cc(Nc2nc(C)nc(C)n2)ccc1/C=C/c1ccc(Nc2nc(C)nc(C)n2)cc1C |
| InChI | InChI=1S/C26H28N8O3S/c1-15-13-22(33-25-29-16(2)27-17(3)30-25)11-9-20(15)7-8-21-10-12-23(14-24(21)38-37-36-35-6)34-26-31-18(4)28-19(5)32-26/h7-14H,1-6H3,(H,27,29,30,33)(H,28,31,32,34)/b8-7+ |
| InChIKey | MQPCKWBDEMTEIO-BQYQJAHWSA-N |
| XLogP | 5.77 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|