C34H30N10 — CID 58933271
2-N-[4-[(E)-2-[4-[(4-anilino-1,3,5-triazin-2-yl)amino]-2-methylphenyl]ethenyl]-3-methylphenyl]-4-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 58933271) has the molecular formula C34H30N10 and a molecular weight of 578.68 g/mol. Its IUPAC name is 2-N-[4-[(E)-2-[4-[(4-anilino-1,3,5-triazin-2-yl)amino]-2-methylphenyl]ethenyl]-3-methylphenyl]-4-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[4-[(E)-2-[4-[(4-anilino-1,3,5-triazin-2-yl)amino]-2-methylphenyl]ethenyl]-3-methylphenyl]-4-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58933271 |
| Molecular Formula | C34H30N10 |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | 2-N-[4-[(E)-2-[4-[(4-anilino-1,3,5-triazin-2-yl)amino]-2-methylphenyl]ethenyl]-3-methylphenyl]-4-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(Nc2ncnc(Nc3ccccc3)n2)ccc1/C=C/c1ccc(Nc2ncnc(Nc3ccccc3)n2)cc1C |
| InChI | InChI=1S/C34H30N10/c1-23-19-29(41-33-37-21-35-31(43-33)39-27-9-5-3-6-10-27)17-15-25(23)13-14-26-16-18-30(20-24(26)2)42-34-38-22-36-32(44-34)40-28-11-7-4-8-12-28/h3-22H,1-2H3,(H2,35,37,39,41,43)(H2,36,38,40,42,44)/b14-13+ |
| InChIKey | RWQMMZFJVDKYNX-BUHFOSPRSA-N |
| XLogP | 7.82 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|