C13H13N3O2 — CID 86053148
2,4-dimethoxy-6-(2-phenylethenyl)-1,3,5-triazine (PubChem CID 86053148) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 2,4-dimethoxy-6-(2-phenylethenyl)-1,3,5-triazine.
| Compound Name | 2,4-dimethoxy-6-(2-phenylethenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 86053148 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2,4-dimethoxy-6-(2-phenylethenyl)-1,3,5-triazine |
| SMILES | COc1nc(C=Cc2ccccc2)nc(OC)n1 |
| InChI | InChI=1S/C13H13N3O2/c1-17-12-14-11(15-13(16-12)18-2)9-8-10-6-4-3-5-7-10/h3-9H,1-2H3 |
| InChIKey | AJYRPKFQKTXSHS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |