C10H7ClN2S — CID 67697151
5-chloro-3-[(E)-2-phenylethenyl]-1,2,4-thiadiazole (PubChem CID 67697151) has the molecular formula C10H7ClN2S and a molecular weight of 222.70 g/mol. Its IUPAC name is 5-chloro-3-[(E)-2-phenylethenyl]-1,2,4-thiadiazole.
| Compound Name | 5-chloro-3-[(E)-2-phenylethenyl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 67697151 |
| Molecular Formula | C10H7ClN2S |
| Molecular Weight | 222.70 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 5-chloro-3-[(E)-2-phenylethenyl]-1,2,4-thiadiazole |
| SMILES | Clc1nc(/C=C/c2ccccc2)ns1 |
| InChI | InChI=1S/C10H7ClN2S/c11-10-12-9(13-14-10)7-6-8-4-2-1-3-5-8/h1-7H/b7-6+ |
| InChIKey | XEVMLHBZYODNOQ-VOTSOKGWSA-N |
| XLogP | 3.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |