C11H9N3 — CID 71366434
3-(2-phenylethenyl)-1,2,4-triazine (PubChem CID 71366434) has the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-(2-phenylethenyl)-1,2,4-triazine.
| Compound Name | 3-(2-phenylethenyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 71366434 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 3-(2-phenylethenyl)-1,2,4-triazine |
| SMILES | C(=Cc1nccnn1)c1ccccc1 |
| InChI | InChI=1S/C11H9N3/c1-2-4-10(5-3-1)6-7-11-12-8-9-13-14-11/h1-9H |
| InChIKey | YJVOFSNVARPYJC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |