C27H18Cl3N3 — CID 6434075
2,4,6-tris[(E)-2-(4-chlorophenyl)ethenyl]-1,3,5-triazine (PubChem CID 6434075) has the molecular formula C27H18Cl3N3 and a molecular weight of 490.82 g/mol. Its IUPAC name is 2,4,6-tris[(E)-2-(4-chlorophenyl)ethenyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[(E)-2-(4-chlorophenyl)ethenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 6434075 |
| Molecular Formula | C27H18Cl3N3 |
| Molecular Weight | 490.82 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | 2,4,6-tris[(E)-2-(4-chlorophenyl)ethenyl]-1,3,5-triazine |
| SMILES | Clc1ccc(/C=C/c2nc(/C=C/c3ccc(Cl)cc3)nc(/C=C/c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C27H18Cl3N3/c28-22-10-1-19(2-11-22)7-16-25-31-26(17-8-20-3-12-23(29)13-4-20)33-27(32-25)18-9-21-5-14-24(30)15-6-21/h1-18H/b16-7+,17-8+,18-9+ |
| InChIKey | ONQNXLIIJOPBFO-HNBPBLOQSA-N |
| XLogP | 8.34 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.82 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |