C63H48N6 — CID 102184385
4-[(E)-2-[4,6-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-1,3,5-triazin-2-yl]ethenyl]-N,N-diphenylaniline (PubChem CID 102184385) has the molecular formula C63H48N6 and a molecular weight of 889.12 g/mol. Its IUPAC name is 4-[(E)-2-[4,6-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-1,3,5-triazin-2-yl]ethenyl]-N,N-diphenylaniline.
| Compound Name | 4-[(E)-2-[4,6-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-1,3,5-triazin-2-yl]ethenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 102184385 |
| Molecular Formula | C63H48N6 |
| Molecular Weight | 889.12 g/mol |
| Exact Mass | 888.39 |
| IUPAC Name | 4-[(E)-2-[4,6-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-1,3,5-triazin-2-yl]ethenyl]-N,N-diphenylaniline |
| SMILES | C(=C/c1nc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)nc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)n1)\c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C63H48N6/c1-7-19-52(20-8-1)67(53-21-9-2-10-22-53)58-40-31-49(32-41-58)37-46-61-64-62(47-38-50-33-42-59(43-34-50)68(54-23-11-3-12-24-54)55-25-13-4-14-26-55)66-63(65-61)48-39-51-35-44-60(45-36-51)69(56-27-15-5-16-28-56)57-29-17-6-18-30-57/h1-48H/b46-37+,47-38+,48-39+ |
| InChIKey | SBBXCDBHQIWUCM-YKPUUXLPSA-N |
| XLogP | 16.79 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.12 |
| LogP ≤ 5 | 16.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |