C18H15ClN2O2 — CID 139921672
4-chloro-6,7-dimethoxy-2-[(E)-2-phenylethenyl]quinazoline (PubChem CID 139921672) has the molecular formula C18H15ClN2O2 and a molecular weight of 326.78 g/mol. Its IUPAC name is 4-chloro-6,7-dimethoxy-2-[(E)-2-phenylethenyl]quinazoline.
| Compound Name | 4-chloro-6,7-dimethoxy-2-[(E)-2-phenylethenyl]quinazoline |
|---|---|
| PubChem CID | 139921672 |
| Molecular Formula | C18H15ClN2O2 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 4-chloro-6,7-dimethoxy-2-[(E)-2-phenylethenyl]quinazoline |
| SMILES | COc1cc2nc(/C=C/c3ccccc3)nc(Cl)c2cc1OC |
| InChI | InChI=1S/C18H15ClN2O2/c1-22-15-10-13-14(11-16(15)23-2)20-17(21-18(13)19)9-8-12-6-4-3-5-7-12/h3-11H,1-2H3/b9-8+ |
| InChIKey | IOHRFSQWIFBNRL-CMDGGOBGSA-N |
| XLogP | 4.47 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |