About 4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline
4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline (PubChem CID 15284500) has the molecular formula C15H12ClN3O2
and a molecular weight of 301.73 g/mol. Its IUPAC name is 4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline.
Molecular Properties
| Compound Name | 4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline |
| PubChem CID | 15284500 |
| Molecular Formula | C15H12ClN3O2 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline |
| SMILES | COc1cc2nc(-c3cccnc3)nc(Cl)c2cc1OC |
| InChI | InChI=1S/C15H12ClN3O2/c1-20-12-6-10-11(7-13(12)21-2)18-15(19-14(10)16)9-4-3-5-17-8-9/h3-8H,1-2H3 |
| InChIKey | MSLISMWLGQWFHY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline?
The IUPAC name of 4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline (CID 15284500) is 4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline.
What is the SMILES notation for 4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline?
The canonical SMILES for 4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline is COc1cc2nc(-c3cccnc3)nc(Cl)c2cc1OC.
What is the InChIKey of 4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline?
The InChIKey is MSLISMWLGQWFHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN3O2/c1-20-12-6-10-11(7-13(12)21-2)18-15(19-14(10)16)9-4-3-5-17-8-9/h3-8H,1-2H3.
What are the key properties of 4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline?
4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline has a molecular weight of 301.73 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6,7-dimethoxy-2-pyridin-3-ylquinazoline is sourced from PubChem (CID 15284500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).