C22H18Cl2N4O2 — CID 71273959
N-(3,5-dichlorophenyl)-6-ethoxy-7-methoxy-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 71273959) has the molecular formula C22H18Cl2N4O2 and a molecular weight of 441.32 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-6-ethoxy-7-methoxy-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-(3,5-dichlorophenyl)-6-ethoxy-7-methoxy-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 71273959 |
| Molecular Formula | C22H18Cl2N4O2 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | N-(3,5-dichlorophenyl)-6-ethoxy-7-methoxy-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | CCOc1cc2c(Nc3cc(Cl)cc(Cl)c3)nc(-c3cccnc3)nc2cc1OC |
| InChI | InChI=1S/C22H18Cl2N4O2/c1-3-30-20-10-17-18(11-19(20)29-2)27-21(13-5-4-6-25-12-13)28-22(17)26-16-8-14(23)7-15(24)9-16/h4-12H,3H2,1-2H3,(H,26,27,28) |
| InChIKey | CHEPPWOOVXEIIU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |