C12H11ClF2N4O3 — CID 619065
N-[4-[chloro(difluoro)methoxy]phenyl]-4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 619065) has the molecular formula C12H11ClF2N4O3 and a molecular weight of 332.69 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 619065 |
| Molecular Formula | C12H11ClF2N4O3 |
| Molecular Weight | 332.69 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(Nc2ccc(OC(F)(F)Cl)cc2)nc(OC)n1 |
| InChI | InChI=1S/C12H11ClF2N4O3/c1-20-10-17-9(18-11(19-10)21-2)16-7-3-5-8(6-4-7)22-12(13,14)15/h3-6H,1-2H3,(H,16,17,18,19) |
| InChIKey | JZNVDROFJJACAK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.69 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|