C10H7BrClIN4O — CID 114262303
N-(3-bromo-4-iodophenyl)-4-chloro-6-methoxy-1,3,5-triazin-2-amine (PubChem CID 114262303) has the molecular formula C10H7BrClIN4O and a molecular weight of 441.45 g/mol. Its IUPAC name is N-(3-bromo-4-iodophenyl)-4-chloro-6-methoxy-1,3,5-triazin-2-amine.
| Compound Name | N-(3-bromo-4-iodophenyl)-4-chloro-6-methoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 114262303 |
| Molecular Formula | C10H7BrClIN4O |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 439.85 |
| IUPAC Name | N-(3-bromo-4-iodophenyl)-4-chloro-6-methoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(Cl)nc(Nc2ccc(I)c(Br)c2)n1 |
| InChI | InChI=1S/C10H7BrClIN4O/c1-18-10-16-8(12)15-9(17-10)14-5-2-3-7(13)6(11)4-5/h2-4H,1H3,(H,14,15,16,17) |
| InChIKey | UFERQUYBSZTRHM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|