C13H11Cl2N9O2 — CID 102286750
2-N,6-N-bis(4-chloro-6-methoxy-1,3,5-triazin-2-yl)pyridine-2,6-diamine (PubChem CID 102286750) has the molecular formula C13H11Cl2N9O2 and a molecular weight of 396.20 g/mol. Its IUPAC name is 2-N,6-N-bis(4-chloro-6-methoxy-1,3,5-triazin-2-yl)pyridine-2,6-diamine.
| Compound Name | 2-N,6-N-bis(4-chloro-6-methoxy-1,3,5-triazin-2-yl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102286750 |
| Molecular Formula | C13H11Cl2N9O2 |
| Molecular Weight | 396.20 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2-N,6-N-bis(4-chloro-6-methoxy-1,3,5-triazin-2-yl)pyridine-2,6-diamine |
| SMILES | COc1nc(Cl)nc(Nc2cccc(Nc3nc(Cl)nc(OC)n3)n2)n1 |
| InChI | InChI=1S/C13H11Cl2N9O2/c1-25-12-21-8(14)19-10(23-12)17-6-4-3-5-7(16-6)18-11-20-9(15)22-13(24-11)26-2/h3-5H,1-2H3,(H2,16,17,18,19,20,21,22,23,24) |
| InChIKey | PRUIEGREOZEMBJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |