C12H11BrClFN4O — CID 104780303
N-(3-bromo-4-fluorophenyl)-4-chloro-6-propoxy-1,3,5-triazin-2-amine (PubChem CID 104780303) has the molecular formula C12H11BrClFN4O and a molecular weight of 361.60 g/mol. Its IUPAC name is N-(3-bromo-4-fluorophenyl)-4-chloro-6-propoxy-1,3,5-triazin-2-amine.
| Compound Name | N-(3-bromo-4-fluorophenyl)-4-chloro-6-propoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 104780303 |
| Molecular Formula | C12H11BrClFN4O |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | N-(3-bromo-4-fluorophenyl)-4-chloro-6-propoxy-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(Cl)nc(Nc2ccc(F)c(Br)c2)n1 |
| InChI | InChI=1S/C12H11BrClFN4O/c1-2-5-20-12-18-10(14)17-11(19-12)16-7-3-4-9(15)8(13)6-7/h3-4,6H,2,5H2,1H3,(H,16,17,18,19) |
| InChIKey | MSNYIEGUULRHBQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |