C13H15ClN4O — CID 55124692
4-chloro-N-(3,4-dimethylphenyl)-6-ethoxy-1,3,5-triazin-2-amine (PubChem CID 55124692) has the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. Its IUPAC name is 4-chloro-N-(3,4-dimethylphenyl)-6-ethoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(3,4-dimethylphenyl)-6-ethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 55124692 |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-chloro-N-(3,4-dimethylphenyl)-6-ethoxy-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(Cl)nc(Nc2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C13H15ClN4O/c1-4-19-13-17-11(14)16-12(18-13)15-10-6-5-8(2)9(3)7-10/h5-7H,4H2,1-3H3,(H,15,16,17,18) |
| InChIKey | NZATZPGMJPNIAN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |