C11H9Cl2FN4O — CID 113399790
4,6-dichloro-N-(4-ethoxy-3-fluorophenyl)-1,3,5-triazin-2-amine (PubChem CID 113399790) has the molecular formula C11H9Cl2FN4O and a molecular weight of 303.12 g/mol. Its IUPAC name is 4,6-dichloro-N-(4-ethoxy-3-fluorophenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(4-ethoxy-3-fluorophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 113399790 |
| Molecular Formula | C11H9Cl2FN4O |
| Molecular Weight | 303.12 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 4,6-dichloro-N-(4-ethoxy-3-fluorophenyl)-1,3,5-triazin-2-amine |
| SMILES | CCOc1ccc(Nc2nc(Cl)nc(Cl)n2)cc1F |
| InChI | InChI=1S/C11H9Cl2FN4O/c1-2-19-8-4-3-6(5-7(8)14)15-11-17-9(12)16-10(13)18-11/h3-5H,2H2,1H3,(H,15,16,17,18) |
| InChIKey | CQLZZVTXUJVBOV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.12 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |