C11H8Cl3FN4O — CID 107576870
4-chloro-N-(3,5-dichloro-4-fluorophenyl)-6-ethoxy-1,3,5-triazin-2-amine (PubChem CID 107576870) has the molecular formula C11H8Cl3FN4O and a molecular weight of 337.57 g/mol. Its IUPAC name is 4-chloro-N-(3,5-dichloro-4-fluorophenyl)-6-ethoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(3,5-dichloro-4-fluorophenyl)-6-ethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 107576870 |
| Molecular Formula | C11H8Cl3FN4O |
| Molecular Weight | 337.57 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 4-chloro-N-(3,5-dichloro-4-fluorophenyl)-6-ethoxy-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(Cl)nc(Nc2cc(Cl)c(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C11H8Cl3FN4O/c1-2-20-11-18-9(14)17-10(19-11)16-5-3-6(12)8(15)7(13)4-5/h3-4H,2H2,1H3,(H,16,17,18,19) |
| InChIKey | CVLNKIQMCFVJMQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|