C7H10Cl2N4O — CID 14027402
4-chloro-N-(2-chloroethyl)-6-ethoxy-1,3,5-triazin-2-amine (PubChem CID 14027402) has the molecular formula C7H10Cl2N4O and a molecular weight of 237.09 g/mol. Its IUPAC name is 4-chloro-N-(2-chloroethyl)-6-ethoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(2-chloroethyl)-6-ethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 14027402 |
| Molecular Formula | C7H10Cl2N4O |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 4-chloro-N-(2-chloroethyl)-6-ethoxy-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(Cl)nc(NCCCl)n1 |
| InChI | InChI=1S/C7H10Cl2N4O/c1-2-14-7-12-5(9)11-6(13-7)10-4-3-8/h2-4H2,1H3,(H,10,11,12,13) |
| InChIKey | QSIWOIOEDXOPOO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|