C9H15ClN4O3 — CID 106197176
4-chloro-N-(2,2-dimethoxyethyl)-6-ethoxy-1,3,5-triazin-2-amine (PubChem CID 106197176) has the molecular formula C9H15ClN4O3 and a molecular weight of 262.70 g/mol. Its IUPAC name is 4-chloro-N-(2,2-dimethoxyethyl)-6-ethoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(2,2-dimethoxyethyl)-6-ethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106197176 |
| Molecular Formula | C9H15ClN4O3 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4-chloro-N-(2,2-dimethoxyethyl)-6-ethoxy-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(Cl)nc(NCC(OC)OC)n1 |
| InChI | InChI=1S/C9H15ClN4O3/c1-4-17-9-13-7(10)12-8(14-9)11-5-6(15-2)16-3/h6H,4-5H2,1-3H3,(H,11,12,13,14) |
| InChIKey | GKYAPGPBAPQFHN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|