C9H16ClN5O2 — CID 106197149
6-chloro-4-N-(2,2-dimethoxyethyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 106197149) has the molecular formula C9H16ClN5O2 and a molecular weight of 261.71 g/mol. Its IUPAC name is 6-chloro-4-N-(2,2-dimethoxyethyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-(2,2-dimethoxyethyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 106197149 |
| Molecular Formula | C9H16ClN5O2 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 6-chloro-4-N-(2,2-dimethoxyethyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | COC(CNc1nc(Cl)nc(N(C)C)n1)OC |
| InChI | InChI=1S/C9H16ClN5O2/c1-15(2)9-13-7(10)12-8(14-9)11-5-6(16-3)17-4/h6H,5H2,1-4H3,(H,11,12,13,14) |
| InChIKey | IBOXRTKSWBSMQY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|