C11H18ClN5O — CID 106405794
4-N-(2-but-3-enoxyethyl)-6-chloro-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 106405794) has the molecular formula C11H18ClN5O and a molecular weight of 271.75 g/mol. Its IUPAC name is 4-N-(2-but-3-enoxyethyl)-6-chloro-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(2-but-3-enoxyethyl)-6-chloro-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 106405794 |
| Molecular Formula | C11H18ClN5O |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-N-(2-but-3-enoxyethyl)-6-chloro-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCCOCCNc1nc(Cl)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H18ClN5O/c1-4-5-7-18-8-6-13-10-14-9(12)15-11(16-10)17(2)3/h4H,1,5-8H2,2-3H3,(H,13,14,15,16) |
| InChIKey | PXFISKUBNPQNMY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|