C9H12Cl2N4O — CID 106405801
N-(2-but-3-enoxyethyl)-4,6-dichloro-1,3,5-triazin-2-amine (PubChem CID 106405801) has the molecular formula C9H12Cl2N4O and a molecular weight of 263.13 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-4,6-dichloro-1,3,5-triazin-2-amine.
| Compound Name | N-(2-but-3-enoxyethyl)-4,6-dichloro-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106405801 |
| Molecular Formula | C9H12Cl2N4O |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-4,6-dichloro-1,3,5-triazin-2-amine |
| SMILES | C=CCCOCCNc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C9H12Cl2N4O/c1-2-3-5-16-6-4-12-9-14-7(10)13-8(11)15-9/h2H,1,3-6H2,(H,12,13,14,15) |
| InChIKey | GVHPGERPPZZMAL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|