C11H17ClN4O — CID 80878028
4-chloro-6-pent-4-enoxy-N-propyl-1,3,5-triazin-2-amine (PubChem CID 80878028) has the molecular formula C11H17ClN4O and a molecular weight of 256.74 g/mol. Its IUPAC name is 4-chloro-6-pent-4-enoxy-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-pent-4-enoxy-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80878028 |
| Molecular Formula | C11H17ClN4O |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 4-chloro-6-pent-4-enoxy-N-propyl-1,3,5-triazin-2-amine |
| SMILES | C=CCCCOc1nc(Cl)nc(NCCC)n1 |
| InChI | InChI=1S/C11H17ClN4O/c1-3-5-6-8-17-11-15-9(12)14-10(16-11)13-7-4-2/h3H,1,4-8H2,2H3,(H,13,14,15,16) |
| InChIKey | GADCQSLMBXHMOM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|