C11H18N4O2 — CID 80861162
4-but-3-enoxy-6-methoxy-N-propyl-1,3,5-triazin-2-amine (PubChem CID 80861162) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-but-3-enoxy-6-methoxy-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-but-3-enoxy-6-methoxy-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80861162 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 4-but-3-enoxy-6-methoxy-N-propyl-1,3,5-triazin-2-amine |
| SMILES | C=CCCOc1nc(NCCC)nc(OC)n1 |
| InChI | InChI=1S/C11H18N4O2/c1-4-6-8-17-11-14-9(12-7-5-2)13-10(15-11)16-3/h4H,1,5-8H2,2-3H3,(H,12,13,14,15) |
| InChIKey | MBEDALHDPZVNLR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|