C9H13ClN4O — CID 80867945
4-chloro-6-prop-2-enoxy-N-propyl-1,3,5-triazin-2-amine (PubChem CID 80867945) has the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. Its IUPAC name is 4-chloro-6-prop-2-enoxy-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-prop-2-enoxy-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80867945 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 4-chloro-6-prop-2-enoxy-N-propyl-1,3,5-triazin-2-amine |
| SMILES | C=CCOc1nc(Cl)nc(NCCC)n1 |
| InChI | InChI=1S/C9H13ClN4O/c1-3-5-11-8-12-7(10)13-9(14-8)15-6-4-2/h4H,2-3,5-6H2,1H3,(H,11,12,13,14) |
| InChIKey | GBLYDJPBPSMWNC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|