C9H9ClF6N4O — CID 102723608
4-chloro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-propyl-1,3,5-triazin-2-amine (PubChem CID 102723608) has the molecular formula C9H9ClF6N4O and a molecular weight of 338.64 g/mol. Its IUPAC name is 4-chloro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 102723608 |
| Molecular Formula | C9H9ClF6N4O |
| Molecular Weight | 338.64 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 4-chloro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCNc1nc(Cl)nc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C9H9ClF6N4O/c1-2-3-17-6-18-5(10)19-7(20-6)21-4(8(11,12)13)9(14,15)16/h4H,2-3H2,1H3,(H,17,18,19,20) |
| InChIKey | YQOSNEUPEPSFMH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.64 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |