C7H4ClF6N3O2 — CID 102722071
2-chloro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-methoxy-1,3,5-triazine (PubChem CID 102722071) has the molecular formula C7H4ClF6N3O2 and a molecular weight of 311.57 g/mol. Its IUPAC name is 2-chloro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-methoxy-1,3,5-triazine.
| Compound Name | 2-chloro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-methoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 102722071 |
| Molecular Formula | C7H4ClF6N3O2 |
| Molecular Weight | 311.57 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | 2-chloro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-methoxy-1,3,5-triazine |
| SMILES | COc1nc(Cl)nc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C7H4ClF6N3O2/c1-18-4-15-3(8)16-5(17-4)19-2(6(9,10)11)7(12,13)14/h2H,1H3 |
| InChIKey | BCUQMTMZCUYWDB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |