C9H11F6N5O — CID 102723624
6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-N,2-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 102723624) has the molecular formula C9H11F6N5O and a molecular weight of 319.21 g/mol. Its IUPAC name is 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-N,2-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-N,2-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 102723624 |
| Molecular Formula | C9H11F6N5O |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-N,2-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(OC(C(F)(F)F)C(F)(F)F)nc(N(C)C)n1 |
| InChI | InChI=1S/C9H11F6N5O/c1-16-5-17-6(20(2)3)19-7(18-5)21-4(8(10,11)12)9(13,14)15/h4H,1-3H3,(H,16,17,18,19) |
| InChIKey | OWPSXMQYFOABQK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |