C14H21F6N5O — CID 1115548
4-N-[(2R)-butan-2-yl]-2-N,2-N-diethyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazine-2,4-diamine (PubChem CID 1115548) has the molecular formula C14H21F6N5O and a molecular weight of 389.34 g/mol. Its IUPAC name is 4-N-[(2R)-butan-2-yl]-2-N,2-N-diethyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[(2R)-butan-2-yl]-2-N,2-N-diethyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 1115548 |
| Molecular Formula | C14H21F6N5O |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 4-N-[(2R)-butan-2-yl]-2-N,2-N-diethyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CC[C@@H](C)Nc1nc(OC(C(F)(F)F)C(F)(F)F)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C14H21F6N5O/c1-5-8(4)21-10-22-11(25(6-2)7-3)24-12(23-10)26-9(13(15,16)17)14(18,19)20/h8-9H,5-7H2,1-4H3,(H,21,22,23,24)/t8-/m1/s1 |
| InChIKey | BCOPQQOZMPSIKT-MRVPVSSYSA-N |
| XLogP | 3.80 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |