C11H19F2N5O — CID 82009098
6-(2,2-difluoroethoxy)-2-N,2-N,4-N-triethyl-1,3,5-triazine-2,4-diamine (PubChem CID 82009098) has the molecular formula C11H19F2N5O and a molecular weight of 275.30 g/mol. Its IUPAC name is 6-(2,2-difluoroethoxy)-2-N,2-N,4-N-triethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2,2-difluoroethoxy)-2-N,2-N,4-N-triethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 82009098 |
| Molecular Formula | C11H19F2N5O |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 6-(2,2-difluoroethoxy)-2-N,2-N,4-N-triethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(OCC(F)F)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C11H19F2N5O/c1-4-14-9-15-10(18(5-2)6-3)17-11(16-9)19-7-8(12)13/h8H,4-7H2,1-3H3,(H,14,15,16,17) |
| InChIKey | RMMNGNPLOYGEOM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |