C16H19F4N5O — CID 129285934
2-N,4-N-diethyl-2-N-phenyl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 129285934) has the molecular formula C16H19F4N5O and a molecular weight of 373.35 g/mol. Its IUPAC name is 2-N,4-N-diethyl-2-N-phenyl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-diethyl-2-N-phenyl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 129285934 |
| Molecular Formula | C16H19F4N5O |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-N,4-N-diethyl-2-N-phenyl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(OCC(F)(F)C(F)F)nc(N(CC)c2ccccc2)n1 |
| InChI | InChI=1S/C16H19F4N5O/c1-3-21-13-22-14(25(4-2)11-8-6-5-7-9-11)24-15(23-13)26-10-16(19,20)12(17)18/h5-9,12H,3-4,10H2,1-2H3,(H,21,22,23,24) |
| InChIKey | CGUPSMZUHINGQN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|