C17H21F4N5O — CID 157249601
2-N,2-N-diethyl-4-N-(3-fluorophenyl)-6-(2,2,3-trifluorobutoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 157249601) has the molecular formula C17H21F4N5O and a molecular weight of 387.38 g/mol. Its IUPAC name is 2-N,2-N-diethyl-4-N-(3-fluorophenyl)-6-(2,2,3-trifluorobutoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-diethyl-4-N-(3-fluorophenyl)-6-(2,2,3-trifluorobutoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 157249601 |
| Molecular Formula | C17H21F4N5O |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-N,2-N-diethyl-4-N-(3-fluorophenyl)-6-(2,2,3-trifluorobutoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(Nc2cccc(F)c2)nc(OCC(F)(F)C(C)F)n1 |
| InChI | InChI=1S/C17H21F4N5O/c1-4-26(5-2)15-23-14(22-13-8-6-7-12(19)9-13)24-16(25-15)27-10-17(20,21)11(3)18/h6-9,11H,4-5,10H2,1-3H3,(H,22,23,24,25) |
| InChIKey | VMPPLZAFWOXPEV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |