C10H14F4N4O — CID 175232801
N,N-diethyl-4-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazin-2-amine (PubChem CID 175232801) has the molecular formula C10H14F4N4O and a molecular weight of 282.24 g/mol. Its IUPAC name is N,N-diethyl-4-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazin-2-amine.
| Compound Name | N,N-diethyl-4-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 175232801 |
| Molecular Formula | C10H14F4N4O |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N,N-diethyl-4-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1ncnc(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C10H14F4N4O/c1-3-18(4-2)8-15-6-16-9(17-8)19-5-10(13,14)7(11)12/h6-7H,3-5H2,1-2H3 |
| InChIKey | LZRGWKJRCKUNEW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|