C7H13ClN4 — CID 162306515
N,N-diethyl-1,3,5-triazin-2-amine;hydrochloride (PubChem CID 162306515) has the molecular formula C7H13ClN4 and a molecular weight of 188.66 g/mol. Its IUPAC name is N,N-diethyl-1,3,5-triazin-2-amine;hydrochloride.
| Compound Name | N,N-diethyl-1,3,5-triazin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 162306515 |
| Molecular Formula | C7H13ClN4 |
| Molecular Weight | 188.66 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | N,N-diethyl-1,3,5-triazin-2-amine;hydrochloride |
| SMILES | CCN(CC)c1ncncn1.Cl |
| InChI | InChI=1S/C7H12N4.ClH/c1-3-11(4-2)7-9-5-8-6-10-7;/h5-6H,3-4H2,1-2H3;1H |
| InChIKey | RVCSSIAGJLATCY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.66 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |