C9H6N10 — CID 101336789
N,N-bis(1,3,5-triazin-2-yl)-1,3,5-triazin-2-amine (PubChem CID 101336789) has the molecular formula C9H6N10 and a molecular weight of 254.22 g/mol. Its IUPAC name is N,N-bis(1,3,5-triazin-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | N,N-bis(1,3,5-triazin-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 101336789 |
| Molecular Formula | C9H6N10 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | N,N-bis(1,3,5-triazin-2-yl)-1,3,5-triazin-2-amine |
| SMILES | c1ncnc(N(c2ncncn2)c2ncncn2)n1 |
| InChI | InChI=1S/C9H6N10/c1-10-2-14-7(13-1)19(8-15-3-11-4-16-8)9-17-5-12-6-18-9/h1-6H |
| InChIKey | UTGOTTUCZSAUEY-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 119.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |