About 2-[2-(1,3,5-triazin-2-yl)ethenyl]-1,3,5-triazine
2-[2-(1,3,5-triazin-2-yl)ethenyl]-1,3,5-triazine (PubChem CID 123406658) has the molecular formula C8H6N6
and a molecular weight of 186.18 g/mol. Its IUPAC name is 2-[2-(1,3,5-triazin-2-yl)ethenyl]-1,3,5-triazine.
Analyze 2-[2-(1,3,5-triazin-2-yl)ethenyl]-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3,5-triazin-2-yl)ethenyl]-1,3,5-triazine?
The IUPAC name of 2-[2-(1,3,5-triazin-2-yl)ethenyl]-1,3,5-triazine (CID 123406658) is 2-[2-(1,3,5-triazin-2-yl)ethenyl]-1,3,5-triazine.
What is the SMILES notation for 2-[2-(1,3,5-triazin-2-yl)ethenyl]-1,3,5-triazine?
The canonical SMILES for 2-[2-(1,3,5-triazin-2-yl)ethenyl]-1,3,5-triazine is C(=Cc1ncncn1)c1ncncn1.
What is the InChIKey of 2-[2-(1,3,5-triazin-2-yl)ethenyl]-1,3,5-triazine?
The InChIKey is MEEURVVDUXIZIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N6/c1(7-11-3-9-4-12-7)2-8-13-5-10-6-14-8/h1-6H.
What are the key properties of 2-[2-(1,3,5-triazin-2-yl)ethenyl]-1,3,5-triazine?
2-[2-(1,3,5-triazin-2-yl)ethenyl]-1,3,5-triazine has a molecular weight of 186.18 g/mol, XLogP of 0.23, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3,5-triazin-2-yl)ethenyl]-1,3,5-triazine is sourced from PubChem (CID 123406658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).