C12H10Cl3N3 — CID 174829734
2-ethenyl-1,3,5-triazine;trichloromethylbenzene (PubChem CID 174829734) has the molecular formula C12H10Cl3N3 and a molecular weight of 302.59 g/mol. Its IUPAC name is 2-ethenyl-1,3,5-triazine;trichloromethylbenzene.
| Compound Name | 2-ethenyl-1,3,5-triazine;trichloromethylbenzene |
|---|---|
| PubChem CID | 174829734 |
| Molecular Formula | C12H10Cl3N3 |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 2-ethenyl-1,3,5-triazine;trichloromethylbenzene |
| SMILES | C=Cc1ncncn1.ClC(Cl)(Cl)c1ccccc1 |
| InChI | InChI=1S/C7H5Cl3.C5H5N3/c8-7(9,10)6-4-2-1-3-5-6;1-2-5-7-3-6-4-8-5/h1-5H;2-4H,1H2 |
| InChIKey | IMCJSPREHKEBHJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|