C24H26N4Si2 — CID 140624579
N-trimethylsilyl-N-triphenylsilyl-1,3,5-triazin-2-amine (PubChem CID 140624579) has the molecular formula C24H26N4Si2 and a molecular weight of 426.67 g/mol. Its IUPAC name is N-trimethylsilyl-N-triphenylsilyl-1,3,5-triazin-2-amine.
| Compound Name | N-trimethylsilyl-N-triphenylsilyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 140624579 |
| Molecular Formula | C24H26N4Si2 |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-trimethylsilyl-N-triphenylsilyl-1,3,5-triazin-2-amine |
| SMILES | C[Si](C)(C)N(c1ncncn1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26N4Si2/c1-29(2,3)28(24-26-19-25-20-27-24)30(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-20H,1-3H3 |
| InChIKey | JRJQKNDQXWTKHS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|