C13H25NSi2 — CID 22924503
2-methyl-N,N-bis(trimethylsilyl)aniline (PubChem CID 22924503) has the molecular formula C13H25NSi2 and a molecular weight of 251.52 g/mol. Its IUPAC name is 2-methyl-N,N-bis(trimethylsilyl)aniline.
| Compound Name | 2-methyl-N,N-bis(trimethylsilyl)aniline |
|---|---|
| PubChem CID | 22924503 |
| Molecular Formula | C13H25NSi2 |
| Molecular Weight | 251.52 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-methyl-N,N-bis(trimethylsilyl)aniline |
| SMILES | Cc1ccccc1N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H25NSi2/c1-12-10-8-9-11-13(12)14(15(2,3)4)16(5,6)7/h8-11H,1-7H3 |
| InChIKey | BCBURZSUHMTTST-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|