C13H17N — CID 142925753
2-methyl-N,N-bis[(E)-prop-1-enyl]aniline (PubChem CID 142925753) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 2-methyl-N,N-bis[(E)-prop-1-enyl]aniline.
| Compound Name | 2-methyl-N,N-bis[(E)-prop-1-enyl]aniline |
|---|---|
| PubChem CID | 142925753 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-methyl-N,N-bis[(E)-prop-1-enyl]aniline |
| SMILES | C/C=C/N(/C=C/C)c1ccccc1C |
| InChI | InChI=1S/C13H17N/c1-4-10-14(11-5-2)13-9-7-6-8-12(13)3/h4-11H,1-3H3/b10-4+,11-5+ |
| InChIKey | DGMOLJWWUIKMKF-ZVSIBQGLSA-N |
| XLogP | 3.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |