About N-(diazomethyl)-N,2-dimethylaniline
N-(diazomethyl)-N,2-dimethylaniline (PubChem CID 160817803) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is N-(diazomethyl)-N,2-dimethylaniline.
Molecular Properties
| Compound Name | N-(diazomethyl)-N,2-dimethylaniline |
| PubChem CID | 160817803 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | N-(diazomethyl)-N,2-dimethylaniline |
| SMILES | Cc1ccccc1N(C)C=[N+]=[N-] |
| InChI | InChI=1S/C9H11N3/c1-8-5-3-4-6-9(8)12(2)7-11-10/h3-7H,1-2H3 |
| InChIKey | SFDCMKVEGOVCBI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 39.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-(diazomethyl)-N,2-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diazomethyl)-N,2-dimethylaniline?
The IUPAC name of N-(diazomethyl)-N,2-dimethylaniline (CID 160817803) is N-(diazomethyl)-N,2-dimethylaniline.
What is the SMILES notation for N-(diazomethyl)-N,2-dimethylaniline?
The canonical SMILES for N-(diazomethyl)-N,2-dimethylaniline is Cc1ccccc1N(C)C=[N+]=[N-].
What is the InChIKey of N-(diazomethyl)-N,2-dimethylaniline?
The InChIKey is SFDCMKVEGOVCBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-8-5-3-4-6-9(8)12(2)7-11-10/h3-7H,1-2H3.
What are the key properties of N-(diazomethyl)-N,2-dimethylaniline?
N-(diazomethyl)-N,2-dimethylaniline has a molecular weight of 161.21 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diazomethyl)-N,2-dimethylaniline is sourced from PubChem (CID 160817803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).