C14H28N2 — CID 176660068
1,2-dimethyl-1-(2-methylphenyl)hydrazine;ethane;propane (PubChem CID 176660068) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 1,2-dimethyl-1-(2-methylphenyl)hydrazine;ethane;propane.
| Compound Name | 1,2-dimethyl-1-(2-methylphenyl)hydrazine;ethane;propane |
|---|---|
| PubChem CID | 176660068 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 1,2-dimethyl-1-(2-methylphenyl)hydrazine;ethane;propane |
| SMILES | CC.CCC.CNN(C)c1ccccc1C |
| InChI | InChI=1S/C9H14N2.C3H8.C2H6/c1-8-6-4-5-7-9(8)11(3)10-2;1-3-2;1-2/h4-7,10H,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | MZGCHEAYMJCFPK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|