C11H17NO2 — CID 57156953
N,N-diethoxy-2-methylaniline (PubChem CID 57156953) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is N,N-diethoxy-2-methylaniline.
| Compound Name | N,N-diethoxy-2-methylaniline |
|---|---|
| PubChem CID | 57156953 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N,N-diethoxy-2-methylaniline |
| SMILES | CCON(OCC)c1ccccc1C |
| InChI | InChI=1S/C11H17NO2/c1-4-13-12(14-5-2)11-9-7-6-8-10(11)3/h6-9H,4-5H2,1-3H3 |
| InChIKey | OJUOITBHMFDYIC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|