C23H39N — CID 159036477
ethane;N-ethyl-N,2-dimethylaniline;1-ethyl-2-methylbenzene (PubChem CID 159036477) has the molecular formula C23H39N and a molecular weight of 329.57 g/mol. Its IUPAC name is ethane;N-ethyl-N,2-dimethylaniline;1-ethyl-2-methylbenzene.
| Compound Name | ethane;N-ethyl-N,2-dimethylaniline;1-ethyl-2-methylbenzene |
|---|---|
| PubChem CID | 159036477 |
| Molecular Formula | C23H39N |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.31 |
| IUPAC Name | ethane;N-ethyl-N,2-dimethylaniline;1-ethyl-2-methylbenzene |
| SMILES | CC.CC.CCN(C)c1ccccc1C.CCc1ccccc1C |
| InChI | InChI=1S/C10H15N.C9H12.2C2H6/c1-4-11(3)10-8-6-5-7-9(10)2;1-3-9-7-5-4-6-8(9)2;2*1-2/h5-8H,4H2,1-3H3;4-7H,3H2,1-2H3;2*1-2H3 |
| InChIKey | JVNCLCSPNDUOMT-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |