C12H24NP — CID 162765401
ethane;methylphosphane;N,N,2-trimethylaniline (PubChem CID 162765401) has the molecular formula C12H24NP and a molecular weight of 213.30 g/mol. Its IUPAC name is ethane;methylphosphane;N,N,2-trimethylaniline.
| Compound Name | ethane;methylphosphane;N,N,2-trimethylaniline |
|---|---|
| PubChem CID | 162765401 |
| Molecular Formula | C12H24NP |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | ethane;methylphosphane;N,N,2-trimethylaniline |
| SMILES | CC.CP.Cc1ccccc1N(C)C |
| InChI | InChI=1S/C9H13N.C2H6.CH5P/c1-8-6-4-5-7-9(8)10(2)3;2*1-2/h4-7H,1-3H3;1-2H3;2H2,1H3 |
| InChIKey | VQNMCNIIHAQSBC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|