C10H17ClN2 — CID 117067186
1,1,2-trimethyl-2-(2-methylphenyl)hydrazine;hydrochloride (PubChem CID 117067186) has the molecular formula C10H17ClN2 and a molecular weight of 200.71 g/mol. Its IUPAC name is 1,1,2-trimethyl-2-(2-methylphenyl)hydrazine;hydrochloride.
| Compound Name | 1,1,2-trimethyl-2-(2-methylphenyl)hydrazine;hydrochloride |
|---|---|
| PubChem CID | 117067186 |
| Molecular Formula | C10H17ClN2 |
| Molecular Weight | 200.71 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1,1,2-trimethyl-2-(2-methylphenyl)hydrazine;hydrochloride |
| SMILES | Cc1ccccc1N(C)N(C)C.Cl |
| InChI | InChI=1S/C10H16N2.ClH/c1-9-7-5-6-8-10(9)12(4)11(2)3;/h5-8H,1-4H3;1H |
| InChIKey | IAYAPQFAZWLQTI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.71 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|