C18H24OSi2 — CID 15526879
[(2S,3S)-3-[dimethyl(phenyl)silyl]oxiran-2-yl]-dimethyl-phenylsilane (PubChem CID 15526879) has the molecular formula C18H24OSi2 and a molecular weight of 312.56 g/mol. Its IUPAC name is [(2S,3S)-3-[dimethyl(phenyl)silyl]oxiran-2-yl]-dimethyl-phenylsilane.
| Compound Name | [(2S,3S)-3-[dimethyl(phenyl)silyl]oxiran-2-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 15526879 |
| Molecular Formula | C18H24OSi2 |
| Molecular Weight | 312.56 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [(2S,3S)-3-[dimethyl(phenyl)silyl]oxiran-2-yl]-dimethyl-phenylsilane |
| SMILES | C[Si](C)(c1ccccc1)[C@@H]1O[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H24OSi2/c1-20(2,15-11-7-5-8-12-15)17-18(19-17)21(3,4)16-13-9-6-10-14-16/h5-14,17-18H,1-4H3/t17-,18-/m0/s1 |
| InChIKey | KEBVKNLHDSDUPW-ROUUACIJSA-N |
| XLogP | 3.06 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|