C15H24Si — CID 11117937
dimethyl-[(1S,2R)-2-methylcyclohexyl]-phenylsilane (PubChem CID 11117937) has the molecular formula C15H24Si and a molecular weight of 232.44 g/mol. Its IUPAC name is dimethyl-[(1S,2R)-2-methylcyclohexyl]-phenylsilane.
| Compound Name | dimethyl-[(1S,2R)-2-methylcyclohexyl]-phenylsilane |
|---|---|
| PubChem CID | 11117937 |
| Molecular Formula | C15H24Si |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | dimethyl-[(1S,2R)-2-methylcyclohexyl]-phenylsilane |
| SMILES | C[C@@H]1CCCC[C@@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H24Si/c1-13-9-7-8-12-15(13)16(2,3)14-10-5-4-6-11-14/h4-6,10-11,13,15H,7-9,12H2,1-3H3/t13-,15+/m1/s1 |
| InChIKey | QYKGPUIQLIESOJ-HIFRSBDPSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|